C21H19Cl2NO2S — CID 123153545
1-(3-chlorophenyl)-5-(4-chlorophenyl)-4-cyclopentylsulfanylpyrrolidine-2,3-dione (PubChem CID 123153545) has the molecular formula C21H19Cl2NO2S and a molecular weight of 420.36 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5-(4-chlorophenyl)-4-cyclopentylsulfanylpyrrolidine-2,3-dione.
| Compound Name | 1-(3-chlorophenyl)-5-(4-chlorophenyl)-4-cyclopentylsulfanylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123153545 |
| Molecular Formula | C21H19Cl2NO2S |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 1-(3-chlorophenyl)-5-(4-chlorophenyl)-4-cyclopentylsulfanylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)C1SC1CCCC1 |
| InChI | InChI=1S/C21H19Cl2NO2S/c22-14-10-8-13(9-11-14)18-20(27-17-6-1-2-7-17)19(25)21(26)24(18)16-5-3-4-15(23)12-16/h3-5,8-12,17-18,20H,1-2,6-7H2 |
| InChIKey | LCCLJXBLRYRSBI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|