C8H15NO — CID 123153618
4-methyl-3-methylidene-1,5-oxazocane (PubChem CID 123153618) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 4-methyl-3-methylidene-1,5-oxazocane.
| Compound Name | 4-methyl-3-methylidene-1,5-oxazocane |
|---|---|
| PubChem CID | 123153618 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 4-methyl-3-methylidene-1,5-oxazocane |
| SMILES | C=C1COCCCNC1C |
| InChI | InChI=1S/C8H15NO/c1-7-6-10-5-3-4-9-8(7)2/h8-9H,1,3-6H2,2H3 |
| InChIKey | BPWZIMNDLPNNFJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|