C19H28FN3O — CID 123154217
1-(3-fluorophenyl)-N-[1-[4-(3-methylbutyl)piperazin-1-yl]ethenoxy]ethanimine (PubChem CID 123154217) has the molecular formula C19H28FN3O and a molecular weight of 333.45 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[1-[4-(3-methylbutyl)piperazin-1-yl]ethenoxy]ethanimine.
| Compound Name | 1-(3-fluorophenyl)-N-[1-[4-(3-methylbutyl)piperazin-1-yl]ethenoxy]ethanimine |
|---|---|
| PubChem CID | 123154217 |
| Molecular Formula | C19H28FN3O |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[1-[4-(3-methylbutyl)piperazin-1-yl]ethenoxy]ethanimine |
| SMILES | C=C(ON=C(C)c1cccc(F)c1)N1CCN(CCC(C)C)CC1 |
| InChI | InChI=1S/C19H28FN3O/c1-15(2)8-9-22-10-12-23(13-11-22)17(4)24-21-16(3)18-6-5-7-19(20)14-18/h5-7,14-15H,4,8-13H2,1-3H3 |
| InChIKey | ZLXMEXFLPDWYRL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|