C25H20ClN3O5 — CID 123155378
4-[4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]benzoic acid (PubChem CID 123155378) has the molecular formula C25H20ClN3O5 and a molecular weight of 477.90 g/mol. Its IUPAC name is 4-[4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]benzoic acid.
| Compound Name | 4-[4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 123155378 |
| Molecular Formula | C25H20ClN3O5 |
| Molecular Weight | 477.90 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 4-[4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(-c3nc4nc(OC5COC6CCOC65)[nH]c4cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C25H20ClN3O5/c26-17-11-18-23(29-25(27-18)34-20-12-33-19-9-10-32-22(19)20)28-21(17)15-5-1-13(2-6-15)14-3-7-16(8-4-14)24(30)31/h1-8,11,19-20,22H,9-10,12H2,(H,30,31)(H,27,28,29) |
| InChIKey | PTCAYJIVTIEWPM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.90 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |