C9H24N4Si — CID 123155717
1-N,1-N',2-N-trimethyl-2-N'-silylcyclohexane-1,1,2,2-tetramine (PubChem CID 123155717) has the molecular formula C9H24N4Si and a molecular weight of 216.40 g/mol. Its IUPAC name is 1-N,1-N',2-N-trimethyl-2-N'-silylcyclohexane-1,1,2,2-tetramine.
| Compound Name | 1-N,1-N',2-N-trimethyl-2-N'-silylcyclohexane-1,1,2,2-tetramine |
|---|---|
| PubChem CID | 123155717 |
| Molecular Formula | C9H24N4Si |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 1-N,1-N',2-N-trimethyl-2-N'-silylcyclohexane-1,1,2,2-tetramine |
| SMILES | CNC1(NC)CCCCC1(NC)N[SiH3] |
| InChI | InChI=1S/C9H24N4Si/c1-10-8(11-2)6-4-5-7-9(8,12-3)13-14/h10-13H,4-7H2,1-3,14H3 |
| InChIKey | VEZCWXWEHGZTHS-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|