C20H22BrN5O — CID 123156063
(2R,5S)-4-(3-bromo-4-isocyanophenyl)-2,5-dimethyl-N-(pyridin-2-ylmethyl)piperazine-1-carboxamide (PubChem CID 123156063) has the molecular formula C20H22BrN5O and a molecular weight of 428.33 g/mol. Its IUPAC name is (2R,5S)-4-(3-bromo-4-isocyanophenyl)-2,5-dimethyl-N-(pyridin-2-ylmethyl)piperazine-1-carboxamide.
| Compound Name | (2R,5S)-4-(3-bromo-4-isocyanophenyl)-2,5-dimethyl-N-(pyridin-2-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 123156063 |
| Molecular Formula | C20H22BrN5O |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | (2R,5S)-4-(3-bromo-4-isocyanophenyl)-2,5-dimethyl-N-(pyridin-2-ylmethyl)piperazine-1-carboxamide |
| SMILES | [C-]#[N+]c1ccc(N2C[C@@H](C)N(C(=O)NCc3ccccn3)C[C@@H]2C)cc1Br |
| InChI | InChI=1S/C20H22BrN5O/c1-14-13-26(20(27)24-11-16-6-4-5-9-23-16)15(2)12-25(14)17-7-8-19(22-3)18(21)10-17/h4-10,14-15H,11-13H2,1-2H3,(H,24,27)/t14-,15+/m0/s1 |
| InChIKey | FLZUPNSSFGRNBY-LSDHHAIUSA-N |
| XLogP | 4.20 |
| TPSA | 52.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|