C21H15N3 — CID 123156148
4-(5,6-dimethylidene-3-phenylpyrazin-2-yl)quinoline (PubChem CID 123156148) has the molecular formula C21H15N3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-(5,6-dimethylidene-3-phenylpyrazin-2-yl)quinoline.
| Compound Name | 4-(5,6-dimethylidene-3-phenylpyrazin-2-yl)quinoline |
|---|---|
| PubChem CID | 123156148 |
| Molecular Formula | C21H15N3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 4-(5,6-dimethylidene-3-phenylpyrazin-2-yl)quinoline |
| SMILES | C=c1nc(-c2ccccc2)c(-c2ccnc3ccccc23)nc1=C |
| InChI | InChI=1S/C21H15N3/c1-14-15(2)24-21(20(23-14)16-8-4-3-5-9-16)18-12-13-22-19-11-7-6-10-17(18)19/h3-13H,1-2H2 |
| InChIKey | PTTUEJFZINLSAT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |