C15H22S — CID 123156793
2-methyl-3-(2-methylhexa-2,4-dien-3-ylsulfanyl)hepta-1,3,5-triene (PubChem CID 123156793) has the molecular formula C15H22S and a molecular weight of 234.41 g/mol. Its IUPAC name is 2-methyl-3-(2-methylhexa-2,4-dien-3-ylsulfanyl)hepta-1,3,5-triene.
| Compound Name | 2-methyl-3-(2-methylhexa-2,4-dien-3-ylsulfanyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 123156793 |
| Molecular Formula | C15H22S |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-methyl-3-(2-methylhexa-2,4-dien-3-ylsulfanyl)hepta-1,3,5-triene |
| SMILES | C=C(C)C(=CC=CC)SC(C=CC)=C(C)C |
| InChI | InChI=1S/C15H22S/c1-7-9-11-15(13(5)6)16-14(10-8-2)12(3)4/h7-11H,5H2,1-4,6H3 |
| InChIKey | LPZBHXZTQQMEQL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|