About (6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane
(6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane (PubChem CID 123156800) has the molecular formula C16H27BrF2OSi
and a molecular weight of 381.38 g/mol. Its IUPAC name is (6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | (6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane |
| PubChem CID | 123156800 |
| Molecular Formula | C16H27BrF2OSi |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OCC1=CCC(F)=C(F)C1Br)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H27BrF2OSi/c1-10(2)21(11(3)4,12(5)6)20-9-13-7-8-14(18)16(19)15(13)17/h7,10-12,15H,8-9H2,1-6H3 |
| InChIKey | WKGJRNRFYKPRQB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane?
The IUPAC name of (6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane (CID 123156800) is (6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane.
What is the SMILES notation for (6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane?
The canonical SMILES for (6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane is CC(C)[Si](OCC1=CCC(F)=C(F)C1Br)(C(C)C)C(C)C.
What is the InChIKey of (6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane?
The InChIKey is WKGJRNRFYKPRQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27BrF2OSi/c1-10(2)21(11(3)4,12(5)6)20-9-13-7-8-14(18)16(19)15(13)17/h7,10-12,15H,8-9H2,1-6H3.
What are the key properties of (6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane?
(6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane has a molecular weight of 381.38 g/mol, XLogP of 6.42, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-4,5-difluorocyclohexa-1,4-dien-1-yl)methoxy-tri(propan-2-yl)silane is sourced from PubChem (CID 123156800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).