C27H28BFN2O4S — CID 123156987
2-[(2-fluorophenyl)methyl]-1-(4-methylphenyl)sulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (PubChem CID 123156987) has the molecular formula C27H28BFN2O4S and a molecular weight of 506.41 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl]-1-(4-methylphenyl)sulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 2-[(2-fluorophenyl)methyl]-1-(4-methylphenyl)sulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 123156987 |
| Molecular Formula | C27H28BFN2O4S |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl]-1-(4-methylphenyl)sulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2c(Cc3ccccc3F)cc3c(B4OC(C)(C)C(C)(C)O4)ccnc32)cc1 |
| InChI | InChI=1S/C27H28BFN2O4S/c1-18-10-12-21(13-11-18)36(32,33)31-20(16-19-8-6-7-9-24(19)29)17-22-23(14-15-30-25(22)31)28-34-26(2,3)27(4,5)35-28/h6-15,17H,16H2,1-5H3 |
| InChIKey | SWYUATWKUPOBRL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|