C20H33NO2 — CID 123157217
6-(3-hydroxybutyl)-6-(hydroxymethyl)-3a-methyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene-3-carbonitrile (PubChem CID 123157217) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 6-(3-hydroxybutyl)-6-(hydroxymethyl)-3a-methyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene-3-carbonitrile.
| Compound Name | 6-(3-hydroxybutyl)-6-(hydroxymethyl)-3a-methyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene-3-carbonitrile |
|---|---|
| PubChem CID | 123157217 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 6-(3-hydroxybutyl)-6-(hydroxymethyl)-3a-methyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene-3-carbonitrile |
| SMILES | CC(O)CCC1(CO)CCCC2C1CCC1(C)C(C#N)CCC21 |
| InChI | InChI=1S/C20H33NO2/c1-14(23)7-11-20(13-22)9-3-4-16-17-6-5-15(12-21)19(17,2)10-8-18(16)20/h14-18,22-23H,3-11,13H2,1-2H3 |
| InChIKey | BPAGQNFKXXOTAJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |