C33H39ClN4O3 — CID 123157251
7-(3-chlorophenyl)-1-[4-(1-methoxy-6-methylisoquinoline-3-carbonyl)-2,2-dimethylpiperazin-1-yl]-3-methyl-2-methyliminohept-5-en-1-one (PubChem CID 123157251) has the molecular formula C33H39ClN4O3 and a molecular weight of 575.15 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-1-[4-(1-methoxy-6-methylisoquinoline-3-carbonyl)-2,2-dimethylpiperazin-1-yl]-3-methyl-2-methyliminohept-5-en-1-one.
| Compound Name | 7-(3-chlorophenyl)-1-[4-(1-methoxy-6-methylisoquinoline-3-carbonyl)-2,2-dimethylpiperazin-1-yl]-3-methyl-2-methyliminohept-5-en-1-one |
|---|---|
| PubChem CID | 123157251 |
| Molecular Formula | C33H39ClN4O3 |
| Molecular Weight | 575.15 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | 7-(3-chlorophenyl)-1-[4-(1-methoxy-6-methylisoquinoline-3-carbonyl)-2,2-dimethylpiperazin-1-yl]-3-methyl-2-methyliminohept-5-en-1-one |
| SMILES | C/N=C(/C(=O)N1CCN(C(=O)c2cc3cc(C)ccc3c(OC)n2)CC1(C)C)C(C)CC=CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C33H39ClN4O3/c1-22-14-15-27-25(18-22)20-28(36-30(27)41-6)31(39)37-16-17-38(33(3,4)21-37)32(40)29(35-5)23(2)10-7-8-11-24-12-9-13-26(34)19-24/h7-9,12-15,18-20,23H,10-11,16-17,21H2,1-6H3/b8-7?,35-29+ |
| InChIKey | JVKQVIQZJYSVLP-MQPFMXBTSA-N |
| XLogP | 6.16 |
| TPSA | 75.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.15 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|