C24H42N6O2 — CID 123157431
3,3-diamino-2-[6-(cyanomethyl)-4-azatricyclo[6.5.1.01,8]tetradecan-3-yl]-N-(4-methoxypiperidin-3-yl)propanamide (PubChem CID 123157431) has the molecular formula C24H42N6O2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 3,3-diamino-2-[6-(cyanomethyl)-4-azatricyclo[6.5.1.01,8]tetradecan-3-yl]-N-(4-methoxypiperidin-3-yl)propanamide.
| Compound Name | 3,3-diamino-2-[6-(cyanomethyl)-4-azatricyclo[6.5.1.01,8]tetradecan-3-yl]-N-(4-methoxypiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 123157431 |
| Molecular Formula | C24H42N6O2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | 3,3-diamino-2-[6-(cyanomethyl)-4-azatricyclo[6.5.1.01,8]tetradecan-3-yl]-N-(4-methoxypiperidin-3-yl)propanamide |
| SMILES | COC1CCNCC1NC(=O)C(C(N)N)C1CC23CCCCCC2(CC(CC#N)CN1)C3 |
| InChI | InChI=1S/C24H42N6O2/c1-32-19-6-10-28-14-18(19)30-22(31)20(21(26)27)17-12-24-8-4-2-3-7-23(24,15-24)11-16(5-9-25)13-29-17/h16-21,28-29H,2-8,10-15,26-27H2,1H3,(H,30,31) |
| InChIKey | BBHQRVTXIGPBFL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|