C20H22F2O3S — CID 123157448
ethyl 3-(2,4-difluorophenyl)-2-[4-(ethylidene-methyl-oxo-λ6-sulfanyl)phenyl]propanoate (PubChem CID 123157448) has the molecular formula C20H22F2O3S and a molecular weight of 380.46 g/mol. Its IUPAC name is ethyl 3-(2,4-difluorophenyl)-2-[4-(ethylidene-methyl-oxo-λ6-sulfanyl)phenyl]propanoate.
| Compound Name | ethyl 3-(2,4-difluorophenyl)-2-[4-(ethylidene-methyl-oxo-λ6-sulfanyl)phenyl]propanoate |
|---|---|
| PubChem CID | 123157448 |
| Molecular Formula | C20H22F2O3S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | ethyl 3-(2,4-difluorophenyl)-2-[4-(ethylidene-methyl-oxo-λ6-sulfanyl)phenyl]propanoate |
| SMILES | CC=S(C)(=O)c1ccc(C(Cc2ccc(F)cc2F)C(=O)OCC)cc1 |
| InChI | InChI=1S/C20H22F2O3S/c1-4-25-20(23)18(12-15-6-9-16(21)13-19(15)22)14-7-10-17(11-8-14)26(3,24)5-2/h5-11,13,18H,4,12H2,1-3H3 |
| InChIKey | NBWKNOGCNVVQRB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|