C19H27F2NO10 — CID 123157685
methyl 5-acetamido-2,3-difluoro-4-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate (PubChem CID 123157685) has the molecular formula C19H27F2NO10 and a molecular weight of 467.42 g/mol. Its IUPAC name is methyl 5-acetamido-2,3-difluoro-4-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate.
| Compound Name | methyl 5-acetamido-2,3-difluoro-4-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 123157685 |
| Molecular Formula | C19H27F2NO10 |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | methyl 5-acetamido-2,3-difluoro-4-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
| SMILES | COC(=O)C1(F)OC(C(OC(C)=O)C(COC(C)=O)OC(C)=O)C(NC(C)=O)C(C)C1F |
| InChI | InChI=1S/C19H27F2NO10/c1-8-14(22-9(2)23)16(32-19(21,17(8)20)18(27)28-6)15(31-12(5)26)13(30-11(4)25)7-29-10(3)24/h8,13-17H,7H2,1-6H3,(H,22,23) |
| InChIKey | CMPRFCCEHGYHPJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|