C30H38N4O2 — CID 123158256
(7E)-7-[4-(6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-yl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-2-methoxy-N,5-dimethylcycloocta-2,7-dien-1-imine (PubChem CID 123158256) has the molecular formula C30H38N4O2 and a molecular weight of 486.66 g/mol. Its IUPAC name is (7E)-7-[4-(6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-yl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-2-methoxy-N,5-dimethylcycloocta-2,7-dien-1-imine.
| Compound Name | (7E)-7-[4-(6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-yl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-2-methoxy-N,5-dimethylcycloocta-2,7-dien-1-imine |
|---|---|
| PubChem CID | 123158256 |
| Molecular Formula | C30H38N4O2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | (7E)-7-[4-(6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-yl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-2-methoxy-N,5-dimethylcycloocta-2,7-dien-1-imine |
| SMILES | C/N=C1/C=C(/c2ccc3c(c2)CN(c2ncnc4c2CC(C)(C)CC4)CCO3)CC(C)CC=C1OC |
| InChI | InChI=1S/C30H38N4O2/c1-20-6-8-28(35-5)26(31-4)16-22(14-20)21-7-9-27-23(15-21)18-34(12-13-36-27)29-24-17-30(2,3)11-10-25(24)32-19-33-29/h7-9,15-16,19-20H,6,10-14,17-18H2,1-5H3/b22-16+,28-8?,31-26- |
| InChIKey | FDWSNHDBYPZVQQ-QWWYBYCISA-N |
| XLogP | 5.80 |
| TPSA | 59.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|