C16H21F3N2 — CID 123158363
1-heptan-2-yl-2-(2,2,2-trifluoroethyl)benzimidazole (PubChem CID 123158363) has the molecular formula C16H21F3N2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-heptan-2-yl-2-(2,2,2-trifluoroethyl)benzimidazole.
| Compound Name | 1-heptan-2-yl-2-(2,2,2-trifluoroethyl)benzimidazole |
|---|---|
| PubChem CID | 123158363 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-heptan-2-yl-2-(2,2,2-trifluoroethyl)benzimidazole |
| SMILES | CCCCCC(C)n1c(CC(F)(F)F)nc2ccccc21 |
| InChI | InChI=1S/C16H21F3N2/c1-3-4-5-8-12(2)21-14-10-7-6-9-13(14)20-15(21)11-16(17,18)19/h6-7,9-10,12H,3-5,8,11H2,1-2H3 |
| InChIKey | ZUIXCRNFFYOAMF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|