C19H33NO2S2 — CID 123158664
N-ethylsulfanyl-N-methyl-4-(2,2,5,5-tetramethylhexan-3-yl)benzenesulfonamide (PubChem CID 123158664) has the molecular formula C19H33NO2S2 and a molecular weight of 371.61 g/mol. Its IUPAC name is N-ethylsulfanyl-N-methyl-4-(2,2,5,5-tetramethylhexan-3-yl)benzenesulfonamide.
| Compound Name | N-ethylsulfanyl-N-methyl-4-(2,2,5,5-tetramethylhexan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 123158664 |
| Molecular Formula | C19H33NO2S2 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-ethylsulfanyl-N-methyl-4-(2,2,5,5-tetramethylhexan-3-yl)benzenesulfonamide |
| SMILES | CCSN(C)S(=O)(=O)c1ccc(C(CC(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H33NO2S2/c1-9-23-20(8)24(21,22)16-12-10-15(11-13-16)17(19(5,6)7)14-18(2,3)4/h10-13,17H,9,14H2,1-8H3 |
| InChIKey | BEBSXTIOODVTFQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|