About 8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid
8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 123158848) has the molecular formula C13H9ClFNO3
and a molecular weight of 281.67 g/mol. Its IUPAC name is 8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid |
| PubChem CID | 123158848 |
| Molecular Formula | C13H9ClFNO3 |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn([C@@H]2C[C@@H]2F)c2c(Cl)cccc2c1=O |
| InChI | InChI=1S/C13H9ClFNO3/c14-8-3-1-2-6-11(8)16(10-4-9(10)15)5-7(12(6)17)13(18)19/h1-3,5,9-10H,4H2,(H,18,19)/t9-,10+/m0/s1 |
| InChIKey | AWQWSADVSTVTOI-VHSXEESVSA-N |
| XLogP | 2.64 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid?
The IUPAC name of 8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid (CID 123158848) is 8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid.
What is the SMILES notation for 8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid?
The canonical SMILES for 8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid is O=C(O)c1cn([C@@H]2C[C@@H]2F)c2c(Cl)cccc2c1=O.
What is the InChIKey of 8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid?
The InChIKey is AWQWSADVSTVTOI-VHSXEESVSA-N. The full InChI is InChI=1S/C13H9ClFNO3/c14-8-3-1-2-6-11(8)16(10-4-9(10)15)5-7(12(6)17)13(18)19/h1-3,5,9-10H,4H2,(H,18,19)/t9-,10+/m0/s1.
What are the key properties of 8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid?
8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid has a molecular weight of 281.67 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid is sourced from PubChem (CID 123158848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).