C20H17F3N6O2S — CID 123158937
1-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazole-2-carbonyl]piperazin-2-one (PubChem CID 123158937) has the molecular formula C20H17F3N6O2S and a molecular weight of 462.46 g/mol. Its IUPAC name is 1-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazole-2-carbonyl]piperazin-2-one.
| Compound Name | 1-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazole-2-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 123158937 |
| Molecular Formula | C20H17F3N6O2S |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 1-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazole-2-carbonyl]piperazin-2-one |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2cnc(C(=O)N3CCNCC3=O)s2)c1 |
| InChI | InChI=1S/C20H17F3N6O2S/c1-11-6-12(8-13(7-11)27-19-25-3-2-15(28-19)20(21,22)23)14-9-26-17(32-14)18(31)29-5-4-24-10-16(29)30/h2-3,6-9,24H,4-5,10H2,1H3,(H,25,27,28) |
| InChIKey | MFAQANHFBAZWBU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|