C17H27N3O — CID 123158947
2-[5-[C-(3-iminobutan-2-yl)-N-methylcarbonimidoyl]-2-methoxyphenyl]-N,N-dimethylethanamine (PubChem CID 123158947) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-[5-[C-(3-iminobutan-2-yl)-N-methylcarbonimidoyl]-2-methoxyphenyl]-N,N-dimethylethanamine.
| Compound Name | 2-[5-[C-(3-iminobutan-2-yl)-N-methylcarbonimidoyl]-2-methoxyphenyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 123158947 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 2-[5-[C-(3-iminobutan-2-yl)-N-methylcarbonimidoyl]-2-methoxyphenyl]-N,N-dimethylethanamine |
| SMILES | [H]/N=C(\C)C(C)/C(=N\C)c1ccc(OC)c(CCN(C)C)c1 |
| InChI | InChI=1S/C17H27N3O/c1-12(13(2)18)17(19-3)15-7-8-16(21-6)14(11-15)9-10-20(4)5/h7-8,11-12,18H,9-10H2,1-6H3/b18-13+,19-17+ |
| InChIKey | RVNMYIPYSGRJQQ-JYRUFNGFSA-N |
| XLogP | 2.89 |
| TPSA | 48.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|