C22H24F6N4O2 — CID 123159088
[5-(3,3,3-trifluoro-1-hydroxypropyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone (PubChem CID 123159088) has the molecular formula C22H24F6N4O2 and a molecular weight of 490.45 g/mol. Its IUPAC name is [5-(3,3,3-trifluoro-1-hydroxypropyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone.
| Compound Name | [5-(3,3,3-trifluoro-1-hydroxypropyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 123159088 |
| Molecular Formula | C22H24F6N4O2 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | [5-(3,3,3-trifluoro-1-hydroxypropyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1n[nH]c2c1CN(C(O)CC(F)(F)F)CC2)N1CCC(c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H24F6N4O2/c23-21(24,25)11-18(33)32-10-7-17-15(12-32)19(30-29-17)20(34)31-8-5-13(6-9-31)14-3-1-2-4-16(14)22(26,27)28/h1-4,13,18,33H,5-12H2,(H,29,30) |
| InChIKey | WCWRBMCYUVJDEA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |