C17H30N2 — CID 123159409
2-(2-ethenyl-4-methylpentyl)-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine (PubChem CID 123159409) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 2-(2-ethenyl-4-methylpentyl)-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine.
| Compound Name | 2-(2-ethenyl-4-methylpentyl)-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
|---|---|
| PubChem CID | 123159409 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 2-(2-ethenyl-4-methylpentyl)-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
| SMILES | C=CC(CC(C)C)CC1CCN2CCCCCC2=N1 |
| InChI | InChI=1S/C17H30N2/c1-4-15(12-14(2)3)13-16-9-11-19-10-7-5-6-8-17(19)18-16/h4,14-16H,1,5-13H2,2-3H3 |
| InChIKey | PGRQTDGMTYLREO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|