C24H25F3N5O9P — CID 123159896
4-(2-amino-6-ethoxypurin-9-yl)-3a-methyl-6-[[2-oxo-4-[3-(trifluoromethyl)phenyl]-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-2-one (PubChem CID 123159896) has the molecular formula C24H25F3N5O9P and a molecular weight of 615.46 g/mol. Its IUPAC name is 4-(2-amino-6-ethoxypurin-9-yl)-3a-methyl-6-[[2-oxo-4-[3-(trifluoromethyl)phenyl]-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-2-one.
| Compound Name | 4-(2-amino-6-ethoxypurin-9-yl)-3a-methyl-6-[[2-oxo-4-[3-(trifluoromethyl)phenyl]-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-2-one |
|---|---|
| PubChem CID | 123159896 |
| Molecular Formula | C24H25F3N5O9P |
| Molecular Weight | 615.46 g/mol |
| Exact Mass | 615.13 |
| IUPAC Name | 4-(2-amino-6-ethoxypurin-9-yl)-3a-methyl-6-[[2-oxo-4-[3-(trifluoromethyl)phenyl]-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-2-one |
| SMILES | CCOc1nc(N)nc2c1ncn2C1OC(COP2(=O)OCCC(c3cccc(C(F)(F)F)c3)O2)C2OC(=O)OC21C |
| InChI | InChI=1S/C24H25F3N5O9P/c1-3-35-19-16-18(30-21(28)31-19)32(11-29-16)20-23(2)17(39-22(33)40-23)15(38-20)10-37-42(34)36-8-7-14(41-42)12-5-4-6-13(9-12)24(25,26)27/h4-6,9,11,14-15,17,20H,3,7-8,10H2,1-2H3,(H2,28,30,31) |
| InChIKey | JRHCMPPKAJSUCX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 168.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|