C17H25NO — CID 123159993
(4E,7Z)-3-methanimidoyl-5,8-dimethyl-6-methylidenetrideca-4,7,9-trien-2-one (PubChem CID 123159993) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (4E,7Z)-3-methanimidoyl-5,8-dimethyl-6-methylidenetrideca-4,7,9-trien-2-one.
| Compound Name | (4E,7Z)-3-methanimidoyl-5,8-dimethyl-6-methylidenetrideca-4,7,9-trien-2-one |
|---|---|
| PubChem CID | 123159993 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (4E,7Z)-3-methanimidoyl-5,8-dimethyl-6-methylidenetrideca-4,7,9-trien-2-one |
| SMILES | [H]/N=C/C(/C=C(\C)C(=C)/C=C(/C)C=CCCC)C(C)=O |
| InChI | InChI=1S/C17H25NO/c1-6-7-8-9-13(2)10-14(3)15(4)11-17(12-18)16(5)19/h8-12,17-18H,3,6-7H2,1-2,4-5H3/b9-8?,13-10-,15-11+,18-12+ |
| InChIKey | ZXOGKCWAYNKCPA-DRVPYPNSSA-N |
| XLogP | 4.65 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|