C17H19F3N4O4 — CID 123160682
7-oxo-6-phenylmethoxy-N'-(3,3,3-trifluoropropanoyl)-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide (PubChem CID 123160682) has the molecular formula C17H19F3N4O4 and a molecular weight of 400.36 g/mol. Its IUPAC name is 7-oxo-6-phenylmethoxy-N'-(3,3,3-trifluoropropanoyl)-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide.
| Compound Name | 7-oxo-6-phenylmethoxy-N'-(3,3,3-trifluoropropanoyl)-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide |
|---|---|
| PubChem CID | 123160682 |
| Molecular Formula | C17H19F3N4O4 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 7-oxo-6-phenylmethoxy-N'-(3,3,3-trifluoropropanoyl)-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide |
| SMILES | O=C(CC(F)(F)F)NNC(=O)C1CCC2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C17H19F3N4O4/c18-17(19,20)8-14(25)21-22-15(26)13-7-6-12-9-23(13)16(27)24(12)28-10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,21,25)(H,22,26) |
| InChIKey | DRTVKTQWWNFVIL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|