About [4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate
[4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate (PubChem CID 123160803) has the molecular formula C12H22N2O4S
and a molecular weight of 290.38 g/mol. Its IUPAC name is [4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate.
Molecular Properties
| Compound Name | [4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate |
| PubChem CID | 123160803 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate |
| SMILES | C/N=C(\N)SC1CC(O)C(O)C(C2(O)CCCC2)O1 |
| InChI | InChI=1S/C12H22N2O4S/c1-14-11(13)19-8-6-7(15)9(16)10(18-8)12(17)4-2-3-5-12/h7-10,15-17H,2-6H2,1H3,(H2,13,14) |
| InChIKey | RNCVCNDNVVZTSV-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate?
The IUPAC name of [4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate (CID 123160803) is [4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate.
What is the SMILES notation for [4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate?
The canonical SMILES for [4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate is C/N=C(\N)SC1CC(O)C(O)C(C2(O)CCCC2)O1.
What is the InChIKey of [4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate?
The InChIKey is RNCVCNDNVVZTSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O4S/c1-14-11(13)19-8-6-7(15)9(16)10(18-8)12(17)4-2-3-5-12/h7-10,15-17H,2-6H2,1H3,(H2,13,14).
What are the key properties of [4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate?
[4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate has a molecular weight of 290.38 g/mol, XLogP of -0.19, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-dihydroxy-6-(1-hydroxycyclopentyl)oxan-2-yl] N'-methylcarbamimidothioate is sourced from PubChem (CID 123160803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).