About [6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium
[6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium (PubChem CID 123160812) has the molecular formula C21H45N2+
and a molecular weight of 325.61 g/mol. Its IUPAC name is [6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium.
Molecular Properties
| Compound Name | [6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium |
| PubChem CID | 123160812 |
| Molecular Formula | C21H45N2+ |
| Molecular Weight | 325.61 g/mol |
| Exact Mass | 325.36 |
| IUPAC Name | [6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium |
| SMILES | CCCC(C)C(=CC(CC)CC(CCCNC)[N+](C)(C)C)CC |
| InChI | InChI=1S/C21H45N2/c1-9-13-18(4)20(11-3)16-19(10-2)17-21(23(6,7)8)14-12-15-22-5/h16,18-19,21-22H,9-15,17H2,1-8H3/q+1 |
| InChIKey | CRLNIITVHDGTOK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium?
The IUPAC name of [6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium (CID 123160812) is [6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium.
What is the SMILES notation for [6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium?
The canonical SMILES for [6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium is CCCC(C)C(=CC(CC)CC(CCCNC)[N+](C)(C)C)CC.
What is the InChIKey of [6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium?
The InChIKey is CRLNIITVHDGTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H45N2/c1-9-13-18(4)20(11-3)16-19(10-2)17-21(23(6,7)8)14-12-15-22-5/h16,18-19,21-22H,9-15,17H2,1-8H3/q+1.
What are the key properties of [6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium?
[6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium has a molecular weight of 325.61 g/mol, XLogP of 5.25, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [6,8-diethyl-9-methyl-1-(methylamino)dodec-7-en-4-yl]-trimethylazanium is sourced from PubChem (CID 123160812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).