About 3,6-dimethyl-2H-1,4-thiazine
3,6-dimethyl-2H-1,4-thiazine (PubChem CID 123161431) has the molecular formula C6H9NS
and a molecular weight of 127.21 g/mol. Its IUPAC name is 3,6-dimethyl-2H-1,4-thiazine.
Molecular Properties
| Compound Name | 3,6-dimethyl-2H-1,4-thiazine |
| PubChem CID | 123161431 |
| Molecular Formula | C6H9NS |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.05 |
| IUPAC Name | 3,6-dimethyl-2H-1,4-thiazine |
| SMILES | CC1=CN=C(C)CS1 |
| InChI | InChI=1S/C6H9NS/c1-5-4-8-6(2)3-7-5/h3H,4H2,1-2H3 |
| InChIKey | ORCKIUWKFSIZKE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dimethyl-2H-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-2H-1,4-thiazine?
The IUPAC name of 3,6-dimethyl-2H-1,4-thiazine (CID 123161431) is 3,6-dimethyl-2H-1,4-thiazine.
What is the SMILES notation for 3,6-dimethyl-2H-1,4-thiazine?
The canonical SMILES for 3,6-dimethyl-2H-1,4-thiazine is CC1=CN=C(C)CS1.
What is the InChIKey of 3,6-dimethyl-2H-1,4-thiazine?
The InChIKey is ORCKIUWKFSIZKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NS/c1-5-4-8-6(2)3-7-5/h3H,4H2,1-2H3.
What are the key properties of 3,6-dimethyl-2H-1,4-thiazine?
3,6-dimethyl-2H-1,4-thiazine has a molecular weight of 127.21 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-2H-1,4-thiazine is sourced from PubChem (CID 123161431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).