About (4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane
(4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane (PubChem CID 123161601) has the molecular formula C14H30O2Si
and a molecular weight of 258.48 g/mol. Its IUPAC name is (4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane.
Molecular Properties
| Compound Name | (4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane |
| PubChem CID | 123161601 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane |
| SMILES | CO[SiH](OC)C(C)(C)C(C)CC1CCCCC1 |
| InChI | InChI=1S/C14H30O2Si/c1-12(11-13-9-7-6-8-10-13)14(2,3)17(15-4)16-5/h12-13,17H,6-11H2,1-5H3 |
| InChIKey | QBOCCJUKZMVFTP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane?
The IUPAC name of (4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane (CID 123161601) is (4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane.
What is the SMILES notation for (4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane?
The canonical SMILES for (4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane is CO[SiH](OC)C(C)(C)C(C)CC1CCCCC1.
What is the InChIKey of (4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane?
The InChIKey is QBOCCJUKZMVFTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O2Si/c1-12(11-13-9-7-6-8-10-13)14(2,3)17(15-4)16-5/h12-13,17H,6-11H2,1-5H3.
What are the key properties of (4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane?
(4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane has a molecular weight of 258.48 g/mol, XLogP of 3.89, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclohexyl-2,3-dimethylbutan-2-yl)-dimethoxysilane is sourced from PubChem (CID 123161601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).