C34H46F4O4S — CID 123161857
11'-(4-ethylsulfanylphenyl)-5,5,13'-trimethyl-17'-(1,1,2,2-tetrafluoropropyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol (PubChem CID 123161857) has the molecular formula C34H46F4O4S and a molecular weight of 626.80 g/mol. Its IUPAC name is 11'-(4-ethylsulfanylphenyl)-5,5,13'-trimethyl-17'-(1,1,2,2-tetrafluoropropyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol.
| Compound Name | 11'-(4-ethylsulfanylphenyl)-5,5,13'-trimethyl-17'-(1,1,2,2-tetrafluoropropyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol |
|---|---|
| PubChem CID | 123161857 |
| Molecular Formula | C34H46F4O4S |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | 11'-(4-ethylsulfanylphenyl)-5,5,13'-trimethyl-17'-(1,1,2,2-tetrafluoropropyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol |
| SMILES | CCSc1ccc(C2CC3(C)C(CCC3(O)C(F)(F)C(C)(F)F)C3CCC4(O)CC5(CCC4=C23)OCC(C)(C)CO5)cc1 |
| InChI | InChI=1S/C34H46F4O4S/c1-6-43-22-9-7-21(8-10-22)24-17-29(4)25(13-16-33(29,40)34(37,38)30(5,35)36)23-11-14-31(39)18-32(15-12-26(31)27(23)24)41-19-28(2,3)20-42-32/h7-10,23-25,39-40H,6,11-20H2,1-5H3 |
| InChIKey | YNGLYSLIAZLHAA-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|