About 2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine
2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine (PubChem CID 123161901) has the molecular formula C10H14F3N
and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine.
Molecular Properties
| Compound Name | 2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine |
| PubChem CID | 123161901 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine |
| SMILES | CCC1C=C(C(F)(F)F)C=C(C)N1C |
| InChI | InChI=1S/C10H14F3N/c1-4-9-6-8(10(11,12)13)5-7(2)14(9)3/h5-6,9H,4H2,1-3H3 |
| InChIKey | ZROPHIGRVGZTOO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine?
The IUPAC name of 2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine (CID 123161901) is 2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine.
What is the SMILES notation for 2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine?
The canonical SMILES for 2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine is CCC1C=C(C(F)(F)F)C=C(C)N1C.
What is the InChIKey of 2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine?
The InChIKey is ZROPHIGRVGZTOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N/c1-4-9-6-8(10(11,12)13)5-7(2)14(9)3/h5-6,9H,4H2,1-3H3.
What are the key properties of 2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine?
2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine has a molecular weight of 205.22 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,6-dimethyl-4-(trifluoromethyl)-2H-pyridine is sourced from PubChem (CID 123161901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).