About tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane
tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 123161934) has the molecular formula C32H38Si
and a molecular weight of 450.74 g/mol. Its IUPAC name is tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane.
Molecular Properties
| Compound Name | tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane |
| PubChem CID | 123161934 |
| Molecular Formula | C32H38Si |
| Molecular Weight | 450.74 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CCCC1=C([Si](c2cc(C)cc(C)c2)(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)CC=C1 |
| InChI | InChI=1S/C32H38Si/c1-8-10-28-11-9-12-32(28)33(29-16-22(2)13-23(3)17-29,30-18-24(4)14-25(5)19-30)31-20-26(6)15-27(7)21-31/h9,11,13-21H,8,10,12H2,1-7H3 |
| InChIKey | YNLCMFVEXGAJPR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.74 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane?
The IUPAC name of tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane (CID 123161934) is tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane.
What is the SMILES notation for tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane?
The canonical SMILES for tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane is CCCC1=C([Si](c2cc(C)cc(C)c2)(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)CC=C1.
What is the InChIKey of tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane?
The InChIKey is YNLCMFVEXGAJPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H38Si/c1-8-10-28-11-9-12-32(28)33(29-16-22(2)13-23(3)17-29,30-18-24(4)14-25(5)19-30)31-20-26(6)15-27(7)21-31/h9,11,13-21H,8,10,12H2,1-7H3.
What are the key properties of tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane?
tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane has a molecular weight of 450.74 g/mol, XLogP of 6.60, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(3,5-dimethylphenyl)-(2-propylcyclopenta-1,3-dien-1-yl)silane is sourced from PubChem (CID 123161934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).