About 1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione
1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione (PubChem CID 123161946) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is 1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione |
| PubChem CID | 123161946 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione |
| SMILES | CN(C)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H13N3O2/c1-10(2)9-5-6-11-7(12)3-4-8(11)13/h3-4,9H,5-6H2,1-2H3 |
| InChIKey | BQHUOBGUMISXAK-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione?
The IUPAC name of 1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione (CID 123161946) is 1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione.
What is the SMILES notation for 1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione?
The canonical SMILES for 1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione is CN(C)NCCN1C(=O)C=CC1=O.
What is the InChIKey of 1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione?
The InChIKey is BQHUOBGUMISXAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-10(2)9-5-6-11-7(12)3-4-8(11)13/h3-4,9H,5-6H2,1-2H3.
What are the key properties of 1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione?
1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione has a molecular weight of 183.21 g/mol, XLogP of -1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrole-2,5-dione is sourced from PubChem (CID 123161946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).