C29H46O3 — CID 123162057
1-ethenyl-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid (PubChem CID 123162057) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is 1-ethenyl-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid.
| Compound Name | 1-ethenyl-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
|---|---|
| PubChem CID | 123162057 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | 1-ethenyl-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
| SMILES | C=CC1CCC2(C(=O)O)CCC3(C)C(CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C29H46O3/c1-7-18-10-15-29(24(31)32)17-16-27(5)19(23(18)29)8-9-21-26(4)13-12-22(30)25(2,3)20(26)11-14-28(21,27)6/h7,18-23,30H,1,8-17H2,2-6H3,(H,31,32) |
| InChIKey | NZNHUHDUTSVFMO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|