C10H17NO — CID 123162376
2-hexa-1,4-dien-3-ylmorpholine (PubChem CID 123162376) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-hexa-1,4-dien-3-ylmorpholine.
| Compound Name | 2-hexa-1,4-dien-3-ylmorpholine |
|---|---|
| PubChem CID | 123162376 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-hexa-1,4-dien-3-ylmorpholine |
| SMILES | C=CC(C=CC)C1CNCCO1 |
| InChI | InChI=1S/C10H17NO/c1-3-5-9(4-2)10-8-11-6-7-12-10/h3-5,9-11H,2,6-8H2,1H3 |
| InChIKey | QPNLOJRHZIWOCK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|