C18H21FN2O3S — CID 123162385
3-fluoro-N-(3-methoxypropyl)-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine (PubChem CID 123162385) has the molecular formula C18H21FN2O3S and a molecular weight of 364.44 g/mol. Its IUPAC name is 3-fluoro-N-(3-methoxypropyl)-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine.
| Compound Name | 3-fluoro-N-(3-methoxypropyl)-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
|---|---|
| PubChem CID | 123162385 |
| Molecular Formula | C18H21FN2O3S |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-fluoro-N-(3-methoxypropyl)-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
| SMILES | COCCCNC1c2ccccc2N(C)S(=O)(=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C18H21FN2O3S/c1-21-16-7-4-3-6-14(16)18(20-10-5-11-24-2)15-9-8-13(19)12-17(15)25(21,22)23/h3-4,6-9,12,18,20H,5,10-11H2,1-2H3 |
| InChIKey | UWBRBYIRBDHYRS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|