C41H49ClN6O — CID 123162562
4-[4-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]-1-ethylpiperidin-2-yl]-N-(1-ethylpiperidin-4-yl)-2-methoxyacridin-9-amine (PubChem CID 123162562) has the molecular formula C41H49ClN6O and a molecular weight of 677.34 g/mol. Its IUPAC name is 4-[4-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]-1-ethylpiperidin-2-yl]-N-(1-ethylpiperidin-4-yl)-2-methoxyacridin-9-amine.
| Compound Name | 4-[4-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]-1-ethylpiperidin-2-yl]-N-(1-ethylpiperidin-4-yl)-2-methoxyacridin-9-amine |
|---|---|
| PubChem CID | 123162562 |
| Molecular Formula | C41H49ClN6O |
| Molecular Weight | 677.34 g/mol |
| Exact Mass | 676.37 |
| IUPAC Name | 4-[4-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]-1-ethylpiperidin-2-yl]-N-(1-ethylpiperidin-4-yl)-2-methoxyacridin-9-amine |
| SMILES | CCN1CCC(Nc2c3ccccc3nc3c(C4CC(Nc5c6c(nc7cc(Cl)ccc57)CCCC6)CCN4CC)cc(OC)cc23)CC1 |
| InChI | InChI=1S/C41H49ClN6O/c1-4-47-19-16-27(17-20-47)43-40-31-11-7-9-13-36(31)46-41-33(24-29(49-3)25-34(40)41)38-23-28(18-21-48(38)5-2)44-39-30-10-6-8-12-35(30)45-37-22-26(42)14-15-32(37)39/h7,9,11,13-15,22,24-25,27-28,38H,4-6,8,10,12,16-21,23H2,1-3H3,(H,43,46)(H,44,45) |
| InChIKey | VOPJJYGRJHRXDT-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.34 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|