About 1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine
1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine (PubChem CID 123163019) has the molecular formula C12H18FN
and a molecular weight of 195.28 g/mol. Its IUPAC name is 1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine.
Molecular Properties
| Compound Name | 1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine |
| PubChem CID | 123163019 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine |
| SMILES | FC1C=CC=CC1CN1CCCCC1 |
| InChI | InChI=1S/C12H18FN/c13-12-7-3-2-6-11(12)10-14-8-4-1-5-9-14/h2-3,6-7,11-12H,1,4-5,8-10H2 |
| InChIKey | QEBZIGZENMCIDJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine?
The IUPAC name of 1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine (CID 123163019) is 1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine.
What is the SMILES notation for 1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine?
The canonical SMILES for 1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine is FC1C=CC=CC1CN1CCCCC1.
What is the InChIKey of 1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine?
The InChIKey is QEBZIGZENMCIDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FN/c13-12-7-3-2-6-11(12)10-14-8-4-1-5-9-14/h2-3,6-7,11-12H,1,4-5,8-10H2.
What are the key properties of 1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine?
1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine has a molecular weight of 195.28 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-fluorocyclohexa-2,4-dien-1-yl)methyl]piperidine is sourced from PubChem (CID 123163019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).