About 1-(aminodiazenyl)-2-buta-1,3-diynylbenzene
1-(aminodiazenyl)-2-buta-1,3-diynylbenzene (PubChem CID 123163694) has the molecular formula C10H7N3
and a molecular weight of 169.19 g/mol. Its IUPAC name is 1-(aminodiazenyl)-2-buta-1,3-diynylbenzene.
Molecular Properties
| Compound Name | 1-(aminodiazenyl)-2-buta-1,3-diynylbenzene |
| PubChem CID | 123163694 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 1-(aminodiazenyl)-2-buta-1,3-diynylbenzene |
| SMILES | C#CC#Cc1ccccc1/N=N/N |
| InChI | InChI=1S/C10H7N3/c1-2-3-6-9-7-4-5-8-10(9)12-13-11/h1,4-5,7-8H,(H2,11,12) |
| InChIKey | PPRRUHDIGFJMMJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(aminodiazenyl)-2-buta-1,3-diynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminodiazenyl)-2-buta-1,3-diynylbenzene?
The IUPAC name of 1-(aminodiazenyl)-2-buta-1,3-diynylbenzene (CID 123163694) is 1-(aminodiazenyl)-2-buta-1,3-diynylbenzene.
What is the SMILES notation for 1-(aminodiazenyl)-2-buta-1,3-diynylbenzene?
The canonical SMILES for 1-(aminodiazenyl)-2-buta-1,3-diynylbenzene is C#CC#Cc1ccccc1/N=N/N.
What is the InChIKey of 1-(aminodiazenyl)-2-buta-1,3-diynylbenzene?
The InChIKey is PPRRUHDIGFJMMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3/c1-2-3-6-9-7-4-5-8-10(9)12-13-11/h1,4-5,7-8H,(H2,11,12).
What are the key properties of 1-(aminodiazenyl)-2-buta-1,3-diynylbenzene?
1-(aminodiazenyl)-2-buta-1,3-diynylbenzene has a molecular weight of 169.19 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminodiazenyl)-2-buta-1,3-diynylbenzene is sourced from PubChem (CID 123163694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).