C40H33F2N3O3 — CID 123164040
N-[5-[9-[4-[[3-(1,1-difluoropropyl)phenoxy]methyl]phenyl]-2-(oxiran-2-ylidene)benzo[h][1,6]naphthyridin-1-yl]-2-methylphenyl]prop-2-enamide (PubChem CID 123164040) has the molecular formula C40H33F2N3O3 and a molecular weight of 641.72 g/mol. Its IUPAC name is N-[5-[9-[4-[[3-(1,1-difluoropropyl)phenoxy]methyl]phenyl]-2-(oxiran-2-ylidene)benzo[h][1,6]naphthyridin-1-yl]-2-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[9-[4-[[3-(1,1-difluoropropyl)phenoxy]methyl]phenyl]-2-(oxiran-2-ylidene)benzo[h][1,6]naphthyridin-1-yl]-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123164040 |
| Molecular Formula | C40H33F2N3O3 |
| Molecular Weight | 641.72 g/mol |
| Exact Mass | 641.25 |
| IUPAC Name | N-[5-[9-[4-[[3-(1,1-difluoropropyl)phenoxy]methyl]phenyl]-2-(oxiran-2-ylidene)benzo[h][1,6]naphthyridin-1-yl]-2-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(N2C(=C3CO3)C=Cc3cnc4ccc(-c5ccc(COc6cccc(C(F)(F)CC)c6)cc5)cc4c32)ccc1C |
| InChI | InChI=1S/C40H33F2N3O3/c1-4-38(46)44-35-21-31(16-9-25(35)3)45-36(37-24-48-37)18-15-29-22-43-34-17-14-28(19-33(34)39(29)45)27-12-10-26(11-13-27)23-47-32-8-6-7-30(20-32)40(41,42)5-2/h4,6-22H,1,5,23-24H2,2-3H3,(H,44,46) |
| InChIKey | FHGKJDZECUMWMC-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.72 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|