C22H24N4O3 — CID 123164067
3-[4-(aminomethyl)phenyl]-6-[2-(3-hydroxypropoxy)phenyl]-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-2-one (PubChem CID 123164067) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-[4-(aminomethyl)phenyl]-6-[2-(3-hydroxypropoxy)phenyl]-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-2-one.
| Compound Name | 3-[4-(aminomethyl)phenyl]-6-[2-(3-hydroxypropoxy)phenyl]-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 123164067 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-[4-(aminomethyl)phenyl]-6-[2-(3-hydroxypropoxy)phenyl]-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-2-one |
| SMILES | NCc1ccc(N2C=C3C=C(c4ccccc4OCCCO)NC3NC2=O)cc1 |
| InChI | InChI=1S/C22H24N4O3/c23-13-15-6-8-17(9-7-15)26-14-16-12-19(24-21(16)25-22(26)28)18-4-1-2-5-20(18)29-11-3-10-27/h1-2,4-9,12,14,21,24,27H,3,10-11,13,23H2,(H,25,28) |
| InChIKey | FIQDOWKVNQMEMT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|