C16H29NO5 — CID 123164143
ditert-butyl (2S)-5-(2-hydroxyethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 123164143) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is ditert-butyl (2S)-5-(2-hydroxyethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S)-5-(2-hydroxyethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 123164143 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | ditert-butyl (2S)-5-(2-hydroxyethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCC(CCO)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO5/c1-15(2,3)21-13(19)12-8-7-11(9-10-18)17(12)14(20)22-16(4,5)6/h11-12,18H,7-10H2,1-6H3/t11?,12-/m0/s1 |
| InChIKey | WAZQUILENWWJEZ-KIYNQFGBSA-N |
| XLogP | 2.48 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |