C18H30O3 — CID 123164680
7-methyl-3,9-di(propan-2-yl)-4,4a,5,6,7,9,10,10a-octahydro-3H-cycloocta[b]pyran-2,8-dione (PubChem CID 123164680) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 7-methyl-3,9-di(propan-2-yl)-4,4a,5,6,7,9,10,10a-octahydro-3H-cycloocta[b]pyran-2,8-dione.
| Compound Name | 7-methyl-3,9-di(propan-2-yl)-4,4a,5,6,7,9,10,10a-octahydro-3H-cycloocta[b]pyran-2,8-dione |
|---|---|
| PubChem CID | 123164680 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 7-methyl-3,9-di(propan-2-yl)-4,4a,5,6,7,9,10,10a-octahydro-3H-cycloocta[b]pyran-2,8-dione |
| SMILES | CC1CCC2CC(C(C)C)C(=O)OC2CC(C(C)C)C1=O |
| InChI | InChI=1S/C18H30O3/c1-10(2)14-9-16-13(7-6-12(5)17(14)19)8-15(11(3)4)18(20)21-16/h10-16H,6-9H2,1-5H3 |
| InChIKey | POFOKEVSZDCBBS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |