C10H17NO5 — CID 123165201
methyl 3-[[(2S)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]prop-2-enoate (PubChem CID 123165201) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is methyl 3-[[(2S)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]prop-2-enoate.
| Compound Name | methyl 3-[[(2S)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 123165201 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | methyl 3-[[(2S)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]prop-2-enoate |
| SMILES | COC(=O)C=CNC(=O)[C@@H](O)C(C)(C)CO |
| InChI | InChI=1S/C10H17NO5/c1-10(2,6-12)8(14)9(15)11-5-4-7(13)16-3/h4-5,8,12,14H,6H2,1-3H3,(H,11,15)/t8-/m1/s1 |
| InChIKey | UBHGRZXGLNTOPY-MRVPVSSYSA-N |
| XLogP | -0.83 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|