C24H31N5O3S — CID 123165238
4-[(4,5-dimethyl-2-pyridinyl)amino]-N,N-bis(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 123165238) has the molecular formula C24H31N5O3S and a molecular weight of 469.61 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-2-pyridinyl)amino]-N,N-bis(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 4-[(4,5-dimethyl-2-pyridinyl)amino]-N,N-bis(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 123165238 |
| Molecular Formula | C24H31N5O3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 4-[(4,5-dimethyl-2-pyridinyl)amino]-N,N-bis(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | COCCN(CCOC)C(=O)C1CCc2c(sc3ncnc(Nc4cc(C)c(C)cn4)c23)C1 |
| InChI | InChI=1S/C24H31N5O3S/c1-15-11-20(25-13-16(15)2)28-22-21-18-6-5-17(12-19(18)33-23(21)27-14-26-22)24(30)29(7-9-31-3)8-10-32-4/h11,13-14,17H,5-10,12H2,1-4H3,(H,25,26,27,28) |
| InChIKey | UABVAPSVYAJULL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |