C8H10F3NO6S — CID 123165652
methyl 2-[(2-methoxy-2-oxoethylidene)-oxo-[(2,2,2-trifluoroacetyl)amino]-λ6-sulfanyl]acetate (PubChem CID 123165652) has the molecular formula C8H10F3NO6S and a molecular weight of 305.23 g/mol. Its IUPAC name is methyl 2-[(2-methoxy-2-oxoethylidene)-oxo-[(2,2,2-trifluoroacetyl)amino]-λ6-sulfanyl]acetate.
| Compound Name | methyl 2-[(2-methoxy-2-oxoethylidene)-oxo-[(2,2,2-trifluoroacetyl)amino]-λ6-sulfanyl]acetate |
|---|---|
| PubChem CID | 123165652 |
| Molecular Formula | C8H10F3NO6S |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | methyl 2-[(2-methoxy-2-oxoethylidene)-oxo-[(2,2,2-trifluoroacetyl)amino]-λ6-sulfanyl]acetate |
| SMILES | COC(=O)C=S(=O)(CC(=O)OC)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO6S/c1-17-5(13)3-19(16,4-6(14)18-2)12-7(15)8(9,10)11/h3H,4H2,1-2H3,(H,12,15,16) |
| InChIKey | QEGCAQFPLDIZCF-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|