C20H32N4O4 — CID 123165773
4-[2-[(2-carbamoylcyclohexanecarbonyl)amino]ethyl]-2-N-ethylcyclohex-4-ene-1,2-dicarboxamide (PubChem CID 123165773) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-[2-[(2-carbamoylcyclohexanecarbonyl)amino]ethyl]-2-N-ethylcyclohex-4-ene-1,2-dicarboxamide.
| Compound Name | 4-[2-[(2-carbamoylcyclohexanecarbonyl)amino]ethyl]-2-N-ethylcyclohex-4-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 123165773 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 4-[2-[(2-carbamoylcyclohexanecarbonyl)amino]ethyl]-2-N-ethylcyclohex-4-ene-1,2-dicarboxamide |
| SMILES | CCNC(=O)C1CC(CCNC(=O)C2CCCCC2C(N)=O)=CCC1C(N)=O |
| InChI | InChI=1S/C20H32N4O4/c1-2-23-20(28)16-11-12(7-8-14(16)18(22)26)9-10-24-19(27)15-6-4-3-5-13(15)17(21)25/h7,13-16H,2-6,8-11H2,1H3,(H2,21,25)(H2,22,26)(H,23,28)(H,24,27) |
| InChIKey | SZSRDHXVSDAHSX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|