C23H33N3O5S — CID 123166112
N-(1-methylcyclopropyl)sulfonyl-2,16-dioxo-3,17-diazatricyclo[15.3.0.04,7]icosa-5,8-diene-4-carboxamide (PubChem CID 123166112) has the molecular formula C23H33N3O5S and a molecular weight of 463.60 g/mol. Its IUPAC name is N-(1-methylcyclopropyl)sulfonyl-2,16-dioxo-3,17-diazatricyclo[15.3.0.04,7]icosa-5,8-diene-4-carboxamide.
| Compound Name | N-(1-methylcyclopropyl)sulfonyl-2,16-dioxo-3,17-diazatricyclo[15.3.0.04,7]icosa-5,8-diene-4-carboxamide |
|---|---|
| PubChem CID | 123166112 |
| Molecular Formula | C23H33N3O5S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-(1-methylcyclopropyl)sulfonyl-2,16-dioxo-3,17-diazatricyclo[15.3.0.04,7]icosa-5,8-diene-4-carboxamide |
| SMILES | CC1(S(=O)(=O)NC(=O)C23C=CC2C=CCCCCCCC(=O)N2CCCC2C(=O)N3)CC1 |
| InChI | InChI=1S/C23H33N3O5S/c1-22(14-15-22)32(30,31)25-21(29)23-13-12-17(23)9-6-4-2-3-5-7-11-19(27)26-16-8-10-18(26)20(28)24-23/h6,9,12-13,17-18H,2-5,7-8,10-11,14-16H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | KXQAAFDXYGZUSJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|