C24H42N+ — CID 123166358
(3-ethyl-6,7-dimethyl-4,5-dimethylidene-3-propyldodeca-1,9-dienyl)-ethylidene-methylazanium (PubChem CID 123166358) has the molecular formula C24H42N+ and a molecular weight of 344.61 g/mol. Its IUPAC name is (3-ethyl-6,7-dimethyl-4,5-dimethylidene-3-propyldodeca-1,9-dienyl)-ethylidene-methylazanium.
| Compound Name | (3-ethyl-6,7-dimethyl-4,5-dimethylidene-3-propyldodeca-1,9-dienyl)-ethylidene-methylazanium |
|---|---|
| PubChem CID | 123166358 |
| Molecular Formula | C24H42N+ |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 344.33 |
| IUPAC Name | (3-ethyl-6,7-dimethyl-4,5-dimethylidene-3-propyldodeca-1,9-dienyl)-ethylidene-methylazanium |
| SMILES | C=C(C(=C)C(C=C/[N+](C)=C/C)(CC)CCC)C(C)C(C)CC=CCC |
| InChI | InChI=1S/C24H42N/c1-10-14-15-16-20(5)21(6)22(7)23(8)24(12-3,17-11-2)18-19-25(9)13-4/h13-15,18-21H,7-8,10-12,16-17H2,1-6,9H3/q+1/b15-14?,19-18?,25-13+ |
| InChIKey | XIERXGIXJCIKIP-MJIATBCISA-N |
| XLogP | 7.17 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|